452-68-6 2-Fluoro-5-Iodotoluene

Nama produk	2-Fluoro-5-Iodotoluene
Nama bahasa Inggris	2-Fluoro-5-Iodotoluene;
MF	C₇H₆FI
Berat Molekul	236.02
InChI	InChI=1/C7H6FI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3
CAS NO	452-68-6
EINECS	207-206-1
Struktur Molekul
Simbol bahaya
Kode Risiko	R36/38:Irritating to eyes and skin.;
Keselamatan Deskripsi	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;