ChemNet > CAS > 4640-68-0 3,4-Dichlorobenzoylacetonitrile
4640-68-0 3,4-Dichlorobenzoylacetonitrile
Nama produk |
3,4-Dichlorobenzoylacetonitrile |
Nama bahasa Inggris |
3,4-Dichlorobenzoylacetonitrile;3-(3,4-dichlorophenyl)-3-oxopropanenitrile |
MF |
C9H5Cl2NO |
Berat Molekul |
214.0481 |
InChI |
InChI=1/C9H5Cl2NO/c10-7-2-1-6(5-8(7)11)9(13)3-4-12/h1-2,5H,3H2 |
CAS NO |
4640-68-0 |
Struktur Molekul |
|
Kepadatan |
1.383g/cm3 |
Titik didih |
398.4°C at 760 mmHg |
Indeks bias |
1.567 |
Titik nyala |
194.7°C |
Tekanan uap |
1.48E-06mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|