ChemNet > CAS > 4712-55-4 Diphenyl phosphite
4712-55-4 Diphenyl phosphite
| Nama produk |
Diphenyl phosphite |
| Nama bahasa Inggris |
Diphenyl phosphite; diphenyl phosphonate; Phosphonic acid diphenyl ester; diphenyl hydrogen phosphite; oxo(diphenoxy)phosphonium |
| MF |
C12H11O3P |
| Berat Molekul |
234.1877 |
| InChI |
InChI=1/C12H11O3P/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10,16H |
| CAS NO |
4712-55-4 |
| EINECS |
225-202-8 |
| Struktur Molekul |
|
| Titik lebur |
12℃ |
| Titik didih |
348.233°C at 760 mmHg |
| Titik nyala |
178.834°C |
| Tekanan uap |
0mmHg at 25°C |
| Simbol bahaya |
 C:Corrosive;
|
| Kode Risiko |
R34:Causes burns.;
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|
