486-70-4 lupinine
Nama produk |
lupinine |
Nama bahasa Inggris |
lupinine; (-)-Lupinine; (1R-trans)-Octahydro-2H-quinolizine-1-methanol; (1R,9aR)-octahydro-2H-quinolizin-1-ylmethanol; (1S,9aR)-octahydro-2H-quinolizin-1-ylmethanol |
MF |
C10H19NO |
Berat Molekul |
169.264 |
InChI |
InChI=1/C10H19NO/c12-8-9-4-3-7-11-6-2-1-5-10(9)11/h9-10,12H,1-8H2/t9-,10-/m1/s1 |
CAS NO |
486-70-4 |
EINECS |
207-638-0 |
Struktur Molekul |
|
Kepadatan |
1.04g/cm3 |
Titik lebur |
68-69℃ |
Titik didih |
270°C at 760 mmHg |
Indeks bias |
1.525 |
Titik nyala |
99.1°C |
Tekanan uap |
0.000928mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|