ChemNet > CAS > 488-23-3 1,2,3,4-Tetramethylbenzene
488-23-3 1,2,3,4-Tetramethylbenzene
Nama produk |
1,2,3,4-Tetramethylbenzene |
Nama bahasa Inggris |
1,2,3,4-Tetramethylbenzene; Prehenitene; 1,2,3,4-tetramethyl-benze |
MF |
C10H14 |
Berat Molekul |
134.2182 |
InChI |
InChI=1/C10H14/c1-7-5-6-8(2)10(4)9(7)3/h5-6H,1-4H3 |
CAS NO |
488-23-3 |
EINECS |
207-673-1 |
Struktur Molekul |
|
Kepadatan |
0.868g/cm3 |
Titik didih |
204°C at 760 mmHg |
Indeks bias |
1.501 |
Titik nyala |
69.7°C |
Tekanan uap |
0.385mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|