ChemNet > CAS > 4884-24-6 Cyclopentylcyclopentanon
4884-24-6 Cyclopentylcyclopentanon
Nama produk |
Cyclopentylcyclopentanon |
Nama bahasa Inggris |
Cyclopentylcyclopentanon; 2-Cyclopentylcyclopentanone; 1,1'-bi(cyclopentyl)-2-one |
MF |
C10H16O |
Berat Molekul |
152.2334 |
InChI |
InChI=1/C10H16O/c11-10-7-3-6-9(10)8-4-1-2-5-8/h8-9H,1-7H2 |
CAS NO |
4884-24-6 |
EINECS |
225-495-2 |
Struktur Molekul |
|
Kepadatan |
1.031g/cm3 |
Titik didih |
232.5°C at 760 mmHg |
Indeks bias |
1.512 |
Titik nyala |
90.3°C |
Tekanan uap |
0.0588mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|