491-78-1 Primuletin
Nama produk |
Primuletin |
Nama bahasa Inggris |
Primuletin; 5-Hydroxyflavone; 5-Hydroxy-2-phenylchromone; 5-hydroxy-2-phenyl-4H-chromen-4-one |
MF |
C15H10O3 |
Berat Molekul |
238.2381 |
InChI |
InChI=1/C15H10O3/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h1-9,16H |
CAS NO |
491-78-1 |
EINECS |
207-743-1 |
Struktur Molekul |
|
Kepadatan |
1.34g/cm3 |
Titik didih |
425°C at 760 mmHg |
Indeks bias |
1.666 |
Titik nyala |
165.4°C |
Tekanan uap |
7.97E-08mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|