ChemNet > CAS > 498-74-8 4-Methoxymetanilyl fluoride
498-74-8 4-Methoxymetanilyl fluoride
Nama produk |
4-Methoxymetanilyl fluoride |
Nama bahasa Inggris |
4-Methoxymetanilyl fluoride; 3-amino-4-methoxyphenylsulphonyl fluoride; Aminomethoxybenzenesulfonylfluoride; 3-Amino-4-methoxAV21428; 3-amino-4-methoxybenzenesulfonyl fluoride; 3-fluorobenzohydrazide |
MF |
C7H7FN2O |
Berat Molekul |
154.1417 |
InChI |
InChI=1/C7H7FN2O/c8-6-3-1-2-5(4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
CAS NO |
498-74-8 |
EINECS |
207-870-2 |
Struktur Molekul |
|
Kepadatan |
1.272g/cm3 |
Titik lebur |
60-65℃ |
Titik didih |
312.6°C at 760 mmHg |
Indeks bias |
1.552 |
Titik nyala |
142.8°C |
Tekanan uap |
0.000224mmHg at 25°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|