50-66-8 6-(Methylthio)purine
Nama produk |
6-(Methylthio)purine |
Nama bahasa Inggris |
6-(Methylthio)purine; 6-(Methylmercapto)purine; 6-(Methylsulfanyl)-9H-purine; 6-(methylsulfanyl)-7H-purine; 6-(methylsulfanyl)-5H-purine |
MF |
C6H6N4S |
Berat Molekul |
166.2036 |
InChI |
InChI=1/C6H6N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-4H,1H3 |
CAS NO |
50-66-8 |
EINECS |
200-057-3 |
Struktur Molekul |
|
Kepadatan |
1.59g/cm3 |
Titik lebur |
221-222℃ |
Titik didih |
290.9°C at 760 mmHg |
Indeks bias |
1.806 |
Titik nyala |
129.7°C |
Tekanan uap |
0.00351mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|