ChemNet > CAS > 5001-36-5 2-(Isopropylideneaminooxy)propionic acid
5001-36-5 2-(Isopropylideneaminooxy)propionic acid
Nama produk |
2-(Isopropylideneaminooxy)propionic acid |
Nama bahasa Inggris |
2-(Isopropylideneaminooxy)propionic acid;2-[(propan-2-ylideneamino)oxy]propanoic acid |
MF |
C6H11NO3 |
Berat Molekul |
145.1564 |
InChI |
InChI=1/C6H11NO3/c1-4(2)7-10-5(3)6(8)9/h5H,1-3H3,(H,8,9) |
CAS NO |
5001-36-5 |
Struktur Molekul |
|
Kepadatan |
1.09g/cm3 |
Titik didih |
235.8°C at 760 mmHg |
Indeks bias |
1.454 |
Titik nyala |
96.4°C |
Tekanan uap |
0.0169mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|