ChemNet > CAS > 51304-58-6 4-Cyano-4-phenylpiperidine hydrochloride
51304-58-6 4-Cyano-4-phenylpiperidine hydrochloride
| Nama produk |
4-Cyano-4-phenylpiperidine hydrochloride |
| Nama bahasa Inggris |
4-Cyano-4-phenylpiperidine hydrochloride; 4-Phenyl-4-piperidinecarbonitrile.HCl; 4-Cyano-4-phenylpiperidine. HCl; 4-phenylpiperidine-4-carbonitrile hydrochloride |
| MF |
C12H15N2 |
| Berat Molekul |
187.2604 |
| InChI |
InChI=1/C12H14N2/c13-10-12(6-8-14-9-7-12)11-4-2-1-3-5-11/h1-5,14H,6-9H2/p+1 |
| CAS NO |
51304-58-6 |
| EINECS |
257-124-5 |
| Struktur Molekul |
|
| Titik lebur |
210-214℃ |
| Titik didih |
344.6°C at 760 mmHg |
| Titik nyala |
162.2°C |
| Tekanan uap |
6.52E-05mmHg at 25°C |
| Simbol bahaya |
 Xn:Harmful;
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|
