ChemNet > CAS > 51362-38-0 6-phenoxynicotinic acid
51362-38-0 6-phenoxynicotinic acid
Nama produk |
6-phenoxynicotinic acid |
Nama bahasa Inggris |
6-phenoxynicotinic acid; 6-phenoxypyridine-3-carboxylic acid |
MF |
C12H9NO3 |
Berat Molekul |
215.2048 |
InChI |
InChI=1/C12H9NO3/c14-12(15)9-6-7-11(13-8-9)16-10-4-2-1-3-5-10/h1-8H,(H,14,15) |
CAS NO |
51362-38-0 |
Struktur Molekul |
|
Kepadatan |
1.298g/cm3 |
Titik lebur |
164℃ |
Titik didih |
391.2°C at 760 mmHg |
Indeks bias |
1.613 |
Titik nyala |
190.4°C |
Tekanan uap |
8.03E-07mmHg at 25°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|