51605-97-1 4-Amino-2-bromocumene
| Nama produk |
4-Amino-2-bromocumene |
| Nama bahasa Inggris |
4-Amino-2-bromocumene; 2-Bromo-4-isopropylaniline; 2-bromo-4-(propan-2-yl)aniline |
| MF |
C9H12BrN |
| Berat Molekul |
214.1023 |
| InChI |
InChI=1/C9H12BrN/c1-6(2)7-3-4-9(11)8(10)5-7/h3-6H,11H2,1-2H3 |
| CAS NO |
51605-97-1 |
| Struktur Molekul |
|
| Kepadatan |
1.355g/cm3 |
| Titik didih |
271.8°C at 760 mmHg |
| Indeks bias |
1.577 |
| Titik nyala |
118.2°C |
| Tekanan uap |
0.00631mmHg at 25°C |
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|