51801-69-5 4-(m-Tolyloxy)-toluene
Nama produk |
4-(m-Tolyloxy)-toluene |
Nama bahasa Inggris |
4-(m-Tolyloxy)-toluene; 3,4-Dimethyldiphenyl ether; 1-methyl-3-(4-methylphenoxy)benzene |
MF |
C14H14O |
Berat Molekul |
198.2604 |
InChI |
InChI=1/C14H14O/c1-11-6-8-13(9-7-11)15-14-5-3-4-12(2)10-14/h3-10H,1-2H3 |
CAS NO |
51801-69-5 |
Struktur Molekul |
|
Kepadatan |
1.029g/cm3 |
Titik didih |
285.8°C at 760 mmHg |
Indeks bias |
1.56 |
Titik nyala |
121.5°C |
Tekanan uap |
0.00471mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|