5197-28-4 2-Bromo-4-nitroanisole
Nama produk |
2-Bromo-4-nitroanisole |
Nama bahasa Inggris |
2-Bromo-4-nitroanisole;Anisole, 2-bromo-4-nitro-; 2-bromo-1-methoxy-4-nitrobenzene |
MF |
C7H6BrNO3 |
Berat Molekul |
232.0314 |
InChI |
InChI=1/C7H6BrNO3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,1H3 |
CAS NO |
5197-28-4 |
EINECS |
225-983-5 |
Struktur Molekul |
|
Kepadatan |
1.64g/cm3 |
Titik lebur |
104-106℃ |
Titik didih |
306.3°C at 760 mmHg |
Indeks bias |
1.581 |
Titik nyala |
139.1°C |
Tekanan uap |
0.00141mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|