ChemNet > CAS > 52605-96-6 2-Chloro-3-methoxypyridine
52605-96-6 2-Chloro-3-methoxypyridine
| Nama produk |
2-Chloro-3-methoxypyridine |
| Nama bahasa Inggris |
2-Chloro-3-methoxypyridine; |
| MF |
C6H6ClNO |
| Berat Molekul |
143.5709 |
| InChI |
InChI=1/C6H6ClNO/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3 |
| CAS NO |
52605-96-6 |
| EINECS |
258-039-6 |
| Struktur Molekul |
|
| Kepadatan |
1.21g/cm3 |
| Titik didih |
210.6°C at 760 mmHg |
| Indeks bias |
1.517 |
| Titik nyala |
81.2°C |
| Tekanan uap |
0.276mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
