ChemNet > CAS > 527-31-1 Hexaketocyclohexane octahydrate
527-31-1 Hexaketocyclohexane octahydrate
| Nama produk |
Hexaketocyclohexane octahydrate |
| Nama bahasa Inggris |
Hexaketocyclohexane octahydrate; cyclohexanehexaone; Trquinoylhydrate; Hexaoxocyclohexane octahydrate; Triquinolyl octahydrate; Cyclohexanehexone; Trquinoyl; cyclohexane-1,2,3,4,5,6-hexone; cyclohexane-1,2,3,4,5,6-hexone octahydrate; cyclohexane-1,2,3,4,5,6-hexaone Octahydrate |
| MF |
C6H16O14 |
| Berat Molekul |
312.1828 |
| InChI |
InChI=1/C6O6.8H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;;;;;;;/h;8*1H2 |
| CAS NO |
527-31-1 |
| EINECS |
208-412-4 |
| Struktur Molekul |
|
| Titik lebur |
90-93℃ |
| Titik didih |
344.7°C at 760 mmHg |
| Titik nyala |
152°C |
| Tekanan uap |
6.49E-05mmHg at 25°C |
| Simbol bahaya |
 Xn:Harmful;
|
| Kode Risiko |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Keselamatan Deskripsi |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
