ChemNet > CAS > 5290-62-0 4-(4-Nitrophenylazo)-1-naphthol
5290-62-0 4-(4-Nitrophenylazo)-1-naphthol
Nama produk |
4-(4-Nitrophenylazo)-1-naphthol |
Nama bahasa Inggris |
4-(4-Nitrophenylazo)-1-naphthol; Magneson II; 4-(4-Nitrophenylalzo)-1-naphthol; 4-[(4-nitrophenyl)hydrazono]naphthalen-1(4H)-one; (4E)-4-[(4-nitrophenyl)hydrazono]naphthalen-1(4H)-one |
MF |
C16H11N3O3 |
Berat Molekul |
293.2768 |
InChI |
InChI=1/C16H11N3O3/c20-16-10-9-15(13-3-1-2-4-14(13)16)18-17-11-5-7-12(8-6-11)19(21)22/h1-10,17H/b18-15+ |
CAS NO |
5290-62-0 |
EINECS |
226-129-4 |
Struktur Molekul |
|
Kepadatan |
1.35g/cm3 |
Titik lebur |
270℃ |
Titik didih |
483.4°C at 760 mmHg |
Indeks bias |
1.673 |
Titik nyala |
246.2°C |
Tekanan uap |
1.68E-09mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|