ChemNet > CAS > 5323-87-5 3-Ethoxy-2-cyclohexen-1-one
5323-87-5 3-Ethoxy-2-cyclohexen-1-one
Nama produk |
3-Ethoxy-2-cyclohexen-1-one |
Nama bahasa Inggris |
3-Ethoxy-2-cyclohexen-1-one; 3-Ethoxy-2-cyclohexene-1-one; 3-ethoxycyclohex-2-en-1-one |
MF |
C8H12O2 |
Berat Molekul |
140.1797 |
InChI |
InChI=1/C8H12O2/c1-2-10-8-5-3-4-7(9)6-8/h6H,2-5H2,1H3 |
CAS NO |
5323-87-5 |
EINECS |
226-190-7 |
Struktur Molekul |
|
Kepadatan |
1g/cm3 |
Titik didih |
250.1°C at 760 mmHg |
Indeks bias |
1.467 |
Titik nyala |
107.2°C |
Tekanan uap |
0.022mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|