ChemNet > CAS > 536-89-0 m-Tolylhydrazine
536-89-0 m-Tolylhydrazine
| Nama produk |
m-Tolylhydrazine |
| Nama bahasa Inggris |
m-Tolylhydrazine; (3-methyl-phenyl)-hydrazine |
| MF |
C7H10N2 |
| Berat Molekul |
122.16 |
| InChI |
InChI=1/C7H10N2/c1-6-3-2-4-7(5-6)9-8/h2-5,9H,8H2,1H3 |
| CAS NO |
536-89-0 |
| EINECS |
208-650-9 |
| Struktur Molekul |
|
| Kepadatan |
1.057 |
| Simbol bahaya |
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|
