ChemNet > CAS > 5393-99-7 4,5-Diphenyl-1,2,3-thiadiazole
5393-99-7 4,5-Diphenyl-1,2,3-thiadiazole
Nama produk |
4,5-Diphenyl-1,2,3-thiadiazole |
Nama bahasa Inggris |
4,5-Diphenyl-1,2,3-thiadiazole; |
MF |
C14H10N2S |
Berat Molekul |
238.3076 |
InChI |
InChI=1/C14H10N2S/c1-3-7-11(8-4-1)13-14(17-16-15-13)12-9-5-2-6-10-12/h1-10H |
CAS NO |
5393-99-7 |
Struktur Molekul |
|
Kepadatan |
1.216g/cm3 |
Titik didih |
361.2°C at 760 mmHg |
Indeks bias |
1.633 |
Titik nyala |
161.9°C |
Tekanan uap |
4.38E-05mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|