ChemNet > CAS > 5466-06-8 Ethyl 3-mercaptopropionate
5466-06-8 Ethyl 3-mercaptopropionate
| Nama produk |
Ethyl 3-mercaptopropionate |
| Nama bahasa Inggris |
Ethyl 3-mercaptopropionate; 3-Mercaptopropionic Acid Ethyl Ester; ethyl 3-sulfanylpropanoate |
| MF |
C5H10O2S |
| Berat Molekul |
134.1967 |
| InChI |
InChI=1/C5H10O2S/c1-2-7-5(6)3-4-8/h8H,2-4H2,1H3 |
| CAS NO |
5466-06-8 |
| EINECS |
226-771-5 |
| Struktur Molekul |
|
| Kepadatan |
1.043g/cm3 |
| Titik didih |
194.3°C at 760 mmHg |
| Indeks bias |
1.454 |
| Titik nyala |
72.8°C |
| Tekanan uap |
0.445mmHg at 25°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
