ChemNet > CAS > 5524-05-0 (+)-Dihydrocarvone
5524-05-0 (+)-Dihydrocarvone
| Nama produk |
(+)-Dihydrocarvone |
| Nama bahasa Inggris |
(+)-Dihydrocarvone; (+)-Dihydrocarvone, mixture of isomers; p-Menth-8(9)-en-2-one; 8-p-Menthen-2-one; (2R,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohexanone; (2S,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohexanone |
| MF |
C10H16O |
| Berat Molekul |
152.2334 |
| InChI |
InChI=1/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-9H,1,4-6H2,2-3H3/t8-,9+/m0/s1 |
| CAS NO |
5524-05-0 |
| EINECS |
226-872-4 |
| Struktur Molekul |
|
| Kepadatan |
0.903g/cm3 |
| Titik didih |
221.5°C at 760 mmHg |
| Indeks bias |
1.457 |
| Titik nyala |
82.6°C |
| Tekanan uap |
0.107mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|
