ChemNet > CAS > 55259-49-9 Tetramethyltetraselenafulvalene
55259-49-9 Tetramethyltetraselenafulvalene
| Nama produk |
Tetramethyltetraselenafulvalene |
| Nama bahasa Inggris |
Tetramethyltetraselenafulvalene; |
| MF |
C10H12Se4 |
| Berat Molekul |
448.0423 |
| InChI |
InChI=1/C10H12Se4/c1-5-6(2)12-9(11-5)10-13-7(3)8(4)14-10/h1-4H3 |
| CAS NO |
55259-49-9 |
| Struktur Molekul |
|
| Titik lebur |
265-270℃ |
| Titik didih |
338.8°C at 760 mmHg |
| Titik nyala |
158.7°C |
| Tekanan uap |
0.000188mmHg at 25°C |
| Simbol bahaya |
 T:Toxic;
|
| Kode Risiko |
R23/25:Toxic by inhalation and if swallowed.;
R33:Danger of cummulative effects.;
|
| Keselamatan Deskripsi |
S20/21:When using do not eat, drink or smoke.;
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
