ChemNet > CAS > 553-17-3 bis(2-methoxyphenyl) carbonate
553-17-3 bis(2-methoxyphenyl) carbonate
| Nama produk |
bis(2-methoxyphenyl) carbonate |
| Nama bahasa Inggris |
bis(2-methoxyphenyl) carbonate; diguaiacyl carbonate; guaiacyl carbonate; Guaiacol carbonate |
| MF |
C15H14O5 |
| Berat Molekul |
274.2687 |
| InChI |
InChI=1/C15H14O5/c1-17-11-7-3-5-9-13(11)19-15(16)20-14-10-6-4-8-12(14)18-2/h3-10H,1-2H3 |
| CAS NO |
553-17-3 |
| EINECS |
209-034-2 |
| Struktur Molekul |
|
| Kepadatan |
1.208g/cm3 |
| Titik didih |
392.6°C at 760 mmHg |
| Indeks bias |
1.552 |
| Titik nyala |
173.7°C |
| Tekanan uap |
2.27E-06mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
