5535-52-4 p-Tolyl vinil sulfon
| Nama produk |
p-Tolyl vinil sulfon |
| Sinonim |
; 4-Metilfenil vinil sulfon; 1- (etenilsulfonil) -4-metilbenzena; 4-metoksi-N'-[(Z)-(3-fenil-4H-pirazol-4-ilidana)metil]benzohidrazida |
| Nama bahasa Inggris |
p-Tolyl vinyl sulphone; 4-Methylphenyl vinyl sulphone; 1-(ethenylsulfonyl)-4-methylbenzene; 4-methoxy-N'-[(Z)-(3-phenyl-4H-pyrazol-4-ylidene)methyl]benzohydrazide |
| MF |
C18H16N4O2 |
| Berat Molekul |
320.3452 |
| InChI |
InChI=1/C18H16N4O2/c1-24-16-9-7-14(8-10-16)18(23)22-20-12-15-11-19-21-17(15)13-5-3-2-4-6-13/h2-12,20H,1H3,(H,22,23)/b15-12- |
| CAS NO |
5535-52-4 |
| Struktur Molekul |
|
| Kepadatan |
1.23g/cm3 |
| Indeks bias |
1.631 |
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|