ChemNet > CAS > 556-90-1 Pseudothiohydantoin
556-90-1 Pseudothiohydantoin
| Nama produk |
Pseudothiohydantoin |
| Nama bahasa Inggris |
Pseudothiohydantoin; 2-imino-1,3-thiazol-4-one; 2-amino-1,3-thiazol-4(5H)-one; 2-Imino-4-thiazolidinone |
| MF |
C3H4N2OS |
| Berat Molekul |
116.1417 |
| InChI |
InChI=1/C3H4N2OS/c4-3-5-2(6)1-7-3/h1H2,(H2,4,5,6) |
| CAS NO |
556-90-1 |
| EINECS |
209-145-6 |
| Struktur Molekul |
|
| Kepadatan |
1.78g/cm3 |
| Titik lebur |
249℃ |
| Titik didih |
253.5°C at 760 mmHg |
| Indeks bias |
1.785 |
| Titik nyala |
107.1°C |
| Tekanan uap |
0.0182mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|
