ChemNet > CAS > 56107-02-9 4-Chloro-3-nitrobenzophenone
56107-02-9 4-Chloro-3-nitrobenzophenone
| Nama produk |
4-Chloro-3-nitrobenzophenone |
| Nama bahasa Inggris |
4-Chloro-3-nitrobenzophenone; (4-Chloro-3-nitrophenyl)phenylmethanone |
| MF |
C13H8ClNO3 |
| Berat Molekul |
261.6605 |
| InChI |
InChI=1/C13H8ClNO3/c14-11-7-6-10(8-12(11)15(17)18)13(16)9-4-2-1-3-5-9/h1-8H |
| CAS NO |
56107-02-9 |
| EINECS |
259-995-7 |
| Struktur Molekul |
|
| Kepadatan |
1.367g/cm3 |
| Titik lebur |
101-107℃ |
| Titik didih |
386.5°C at 760 mmHg |
| Indeks bias |
1.623 |
| Titik nyala |
203.4°C |
| Tekanan uap |
3.53E-06mmHg at 25°C |
| Simbol bahaya |
 Xn:Harmful;
|
| Kode Risiko |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Keselamatan Deskripsi |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
