ChemNet > CAS > 576-82-9 5-Fluoro-1,2,3-tribromobenzena
576-82-9 5-Fluoro-1,2,3-tribromobenzena
Nama produk |
5-Fluoro-1,2,3-tribromobenzena |
Sinonim |
; 1,2,3-Tribromo-5-fluorobenzena |
Nama bahasa Inggris |
5-Fluoro-1,2,3-tribromobenzene; 1,2,3-Tribromo-5-fluorobenzene |
MF |
C6H2Br3F |
Berat Molekul |
332.7905 |
InChI |
InChI=1/C6H2Br3F/c7-4-1-3(10)2-5(8)6(4)9/h1-2H |
CAS NO |
576-82-9 |
Struktur Molekul |
|
Kepadatan |
2.34g/cm3 |
Titik didih |
274.2°C at 760 mmHg |
Indeks bias |
1.61 |
Titik nyala |
119.6°C |
Tekanan uap |
0.0092mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|