ChemNet > CAS > 5905-69-1 4-(difluoromethoxy)bromobenzene
5905-69-1 4-(difluoromethoxy)bromobenzene
| Nama produk |
4-(difluoromethoxy)bromobenzene |
| Nama bahasa Inggris |
4-(difluoromethoxy)bromobenzene; 1-Bromo-4-(difluoromethoxy)benzene; p-Difluoromethoxybromobenzene |
| MF |
C7H5BrF2O |
| Berat Molekul |
223.0148 |
| InChI |
InChI=1/C7H5BrF2O/c8-5-1-3-6(4-2-5)11-7(9)10/h1-4,7H |
| CAS NO |
5905-69-1 |
| Struktur Molekul |
|
| Kepadatan |
1.583g/cm3 |
| Titik didih |
205.406°C at 760 mmHg |
| Indeks bias |
1.492 |
| Titik nyala |
92.591°C |
| Tekanan uap |
0.359mmHg at 25°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
