ChemNet > CAS > 5933-32-4 4-Bromobenzhydrazide
5933-32-4 4-Bromobenzhydrazide
Nama produk |
4-Bromobenzhydrazide |
Nama bahasa Inggris |
4-Bromobenzhydrazide; 4-Bromobenzoic hydrazide; 4-bromobenzohydrazide |
MF |
C7H7BrN2O |
Berat Molekul |
215.0473 |
InChI |
InChI=1/C7H7BrN2O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
CAS NO |
5933-32-4 |
EINECS |
227-681-9 |
Struktur Molekul |
|
Kepadatan |
1.615g/cm3 |
Titik lebur |
165-167℃ |
Titik didih |
353.2°C at 760 mmHg |
Indeks bias |
1.615 |
Titik nyala |
167.4°C |
Tekanan uap |
1.34E-05mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|