| Nama produk |
Asam alfa-D-glukoheptonat Gamma-lakton |
| Sinonim |
; alfa-D-Glukoheptonic gamma-lakton; (4S,5S)-3,4-dihidroksi-5-[(1R,2R)-1,2,3-trihidroksipropil]dihidrofuran-2(3H)-satu (nama tidak disukai); (3R,4S,5S)-3,4-dihidroksi-5-[(1R,2R)-1,2,3-trihidroksipropil]dihidrofuran-2(3H)-satu (nama yang tidak disukai) |
| Nama bahasa Inggris |
Alpha-D-Glucoheptonic acid Gamma-lactone; alpha-D-Glucoheptonic gamma-lactone; (4S,5S)-3,4-dihydroxy-5-[(1R,2R)-1,2,3-trihydroxypropyl]dihydrofuran-2(3H)-one (non-preferred name); (3R,4S,5S)-3,4-dihydroxy-5-[(1R,2R)-1,2,3-trihydroxypropyl]dihydrofuran-2(3H)-one (non-preferred name) |
| MF |
C7H12O7 |
| Berat Molekul |
208.166 |
| InChI |
InChI=1/C7H12O7/c8-1-2(9)3(10)6-4(11)5(12)7(13)14-6/h2-6,8-12H,1H2/t2-,3-,4+,5-,6+/m1/s1 |
| CAS NO |
60046-25-5 |
| EINECS |
262-037-0 |
| Struktur Molekul |
|
| Kepadatan |
1.806g/cm3 |
| Titik lebur |
152-155℃ |
| Titik didih |
557.5°C at 760 mmHg |
| Indeks bias |
1.645 |
| Titik nyala |
232.1°C |
| Tekanan uap |
9.41E-15mmHg at 25°C |
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|