603-52-1 ethyl diphenylcarbamate
Nama produk |
ethyl diphenylcarbamate |
Nama bahasa Inggris |
ethyl diphenylcarbamate; |
MF |
C15H15NO2 |
Berat Molekul |
241.2851 |
InChI |
InChI=1/C15H15NO2/c1-2-18-15(17)16(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
CAS NO |
603-52-1 |
EINECS |
210-047-0 |
Struktur Molekul |
|
Kepadatan |
1.146g/cm3 |
Titik lebur |
70-72℃ |
Titik didih |
360°C at 760 mmHg |
Indeks bias |
1.593 |
Titik nyala |
171.5°C |
Tekanan uap |
2.29E-05mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|