ChemNet > CAS > 6035-71-8 alpha-furildioxime monohydrate, campuran I
6035-71-8 alpha-furildioxime monohydrate, campuran I
| Nama produk |
alpha-furildioxime monohydrate, campuran I |
| Sinonim |
; alpha-Furil dioxime monohydrate; alpha-Furildioxime, campuran isomer monohidrat; 2,2-Furyldioxime monohidrat |
| Nama bahasa Inggris |
alpha-furildioxime monohydrate, mixture of I; alpha-Furil dioxime monohydrate; alpha-Furildioxime,mixture of isomers monohydrate; 2,2-Furyldioxime monohydrate |
| MF |
C10H10N2O5 |
| Berat Molekul |
238.1968 |
| InChI |
InChI=1/C10H8N2O4.H2O/c13-11-9(7-3-1-5-15-7)10(12-14)8-4-2-6-16-8;/h1-6,11,13H;1H2/b10-9+; |
| CAS NO |
6035-71-8 |
| Struktur Molekul |
|
| Titik lebur |
166-168℃ |
| Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|