ChemNet > CAS > 61040-81-1 3,5-Dimethoxy-4-methylbenzoic acid
61040-81-1 3,5-Dimethoxy-4-methylbenzoic acid
Nama produk |
3,5-Dimethoxy-4-methylbenzoic acid |
Nama bahasa Inggris |
3,5-Dimethoxy-4-methylbenzoic acid; 3,5-Dimethoxy-p-toluic acid (COOH=1) |
MF |
C10H12O4 |
Berat Molekul |
196.1999 |
InChI |
InChI=1/C10H12O4/c1-6-8(13-2)4-7(10(11)12)5-9(6)14-3/h4-5H,1-3H3,(H,11,12) |
CAS NO |
61040-81-1 |
Struktur Molekul |
|
Kepadatan |
1.18g/cm3 |
Titik lebur |
211-216℃ |
Titik didih |
347.7°C at 760 mmHg |
Indeks bias |
1.53 |
Titik nyala |
137.8°C |
Tekanan uap |
1.99E-05mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|