ChemNet > CAS > 611-15-4 o-Vinyltoluene
611-15-4 o-Vinyltoluene
| Nama produk |
o-Vinyltoluene |
| Nama bahasa Inggris |
o-Vinyltoluene; 2-Methylstyrene; 2-Vinyltoluene |
| MF |
C9H10 |
| Berat Molekul |
118.17 |
| InChI |
InChI=1/C9H10/c1-3-9-7-5-4-6-8(9)2/h3-7H,1H2,2H3 |
| CAS NO |
611-15-4 |
| EINECS |
210-256-7 |
| Struktur Molekul |
|
| Kepadatan |
0.916 |
| Simbol bahaya |
|
| Kode Risiko |
R20:Harmful by inhalation.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Keselamatan Deskripsi |
S24:Avoid contact with skin.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
