ChemNet > CAS > 612-28-2 N-Methyl-2-nitroaniline
612-28-2 N-Methyl-2-nitroaniline
| Nama produk |
N-Methyl-2-nitroaniline |
| Nama bahasa Inggris |
N-Methyl-2-nitroaniline;Benzenamine, N-methyl-2-nitro-; 2-Nitro-N-methylaniline; 4-12-00-01564 (Beilstein Handbook Reference); Aniline, N-methyl-o-nitro-; BRN 2209110; N-Methyl-2-nitrobenzenamine; N-Methyl-o-nitroaniline; NSC 86672; o-(Methylamino)nitrobenzene; o-Nitro-N-methylaniline |
| MF |
C7H8N2O2 |
| Berat Molekul |
152.1506 |
| InChI |
InChI=1/C7H8N2O2/c1-8-6-4-2-3-5-7(6)9(10)11/h2-5,8H,1H3 |
| CAS NO |
612-28-2 |
| EINECS |
210-303-1 |
| Struktur Molekul |
|
| Kepadatan |
1.26g/cm3 |
| Titik lebur |
33-37℃ |
| Titik didih |
277.9°C at 760 mmHg |
| Indeks bias |
1.619 |
| Titik nyala |
121.9°C |
| Tekanan uap |
0.0044mmHg at 25°C |
| Simbol bahaya |
 T:Toxic;
|
| Kode Risiko |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| Keselamatan Deskripsi |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
