6135-31-5 Metil N-etilkarbamat
Nama produk |
Metil N-etilkarbamat |
Sinonim |
; N-Etilkarbamat asam metil ester; metil etilkarbamat |
Nama bahasa Inggris |
Methyl N-ethylcarbamate; N-Ethylcarbamic acid methyl ester; methyl ethylcarbamate |
MF |
C4H9NO2 |
Berat Molekul |
103.1198 |
InChI |
InChI=1/C4H9NO2/c1-3-5-4(6)7-2/h3H2,1-2H3,(H,5,6) |
CAS NO |
6135-31-5 |
Struktur Molekul |
|
Kepadatan |
0.964g/cm3 |
Titik didih |
172°C at 760 mmHg |
Indeks bias |
1.4 |
Titik nyala |
57.8°C |
Tekanan uap |
1.36mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|