6138-90-5 Geranyl Bromide
Nama produk |
Geranyl Bromide |
Nama bahasa Inggris |
Geranyl Bromide; 3,7-Dimethyl-2,6-octadienyl bromide; 3,7-Dimethyl-2,6-octadienyl bromide; (2E)-1-bromo-3,7-dimethylocta-2,6-diene |
MF |
C10H17Br |
Berat Molekul |
217.146 |
InChI |
InChI=1/C10H17Br/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6,8H2,1-3H3/b10-7+ |
CAS NO |
6138-90-5 |
EINECS |
228-123-7 |
Struktur Molekul |
|
Kepadatan |
1.121g/cm3 |
Titik didih |
227.7°C at 760 mmHg |
Indeks bias |
1.489 |
Titik nyala |
95°C |
Tekanan uap |
0.115mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|