ChemNet > CAS > 61439-59-6 2-(4-Benzyloxyphenyl)ethanol
61439-59-6 2-(4-Benzyloxyphenyl)ethanol
Nama produk |
2-(4-Benzyloxyphenyl)ethanol |
Nama bahasa Inggris |
2-(4-Benzyloxyphenyl)ethanol; p-Benzyloxyphenethyl alcohol |
MF |
C15H16O2 |
Berat Molekul |
228.2863 |
InChI |
InChI=1/C15H16O2/c16-11-10-13-6-8-15(9-7-13)17-12-14-4-2-1-3-5-14/h1-9,16H,10-12H2 |
CAS NO |
61439-59-6 |
EINECS |
262-795-2 |
Struktur Molekul |
|
Kepadatan |
1.116g/cm3 |
Titik didih |
379.1°C at 760 mmHg |
Indeks bias |
1.584 |
Titik nyala |
170.1°C |
Tekanan uap |
2.02E-06mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|