ChemNet > CAS > 6228-73-5 Cyclopropanecarboxamide
6228-73-5 Cyclopropanecarboxamide
| Nama produk |
Cyclopropanecarboxamide |
| Nama bahasa Inggris |
Cyclopropanecarboxamide; AI3-62011; Carbamoylcyclopropane; Cyclopropylcarboxamide; NSC 402033 |
| MF |
C4H7NO |
| Berat Molekul |
85.1045 |
| InChI |
InChI=1/C4H7NO/c5-4(6)3-1-2-3/h3H,1-2H2,(H2,5,6) |
| CAS NO |
6228-73-5 |
| EINECS |
228-332-3 |
| Struktur Molekul |
|
| Kepadatan |
1.187g/cm3 |
| Titik didih |
248.5°C at 760 mmHg |
| Indeks bias |
1.524 |
| Titik nyala |
104.1°C |
| Tekanan uap |
0.0242mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
