ChemNet > CAS > 62348-13-4 Isoxazole-5-carbonyl chloride
62348-13-4 Isoxazole-5-carbonyl chloride
Nama produk |
Isoxazole-5-carbonyl chloride |
Nama bahasa Inggris |
Isoxazole-5-carbonyl chloride; 5-Isoxazolecarboxylic acid chloride; Isoxazole-5-carbonychlordie |
MF |
C4H2ClNO2 |
Berat Molekul |
131.5172 |
InChI |
InChI=1/C4H2ClNO2/c5-4(7)3-1-2-6-8-3/h1-2H |
CAS NO |
62348-13-4 |
Struktur Molekul |
|
Kepadatan |
1.432g/cm3 |
Titik didih |
213.213°C at 760 mmHg |
Indeks bias |
1.497 |
Titik nyala |
82.749°C |
Tekanan uap |
0.166mmHg at 25°C |
Simbol bahaya |
C:Corrosive;
|
Kode Risiko |
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|