ChemNet > CAS > 6435-75-2 4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylic acid
6435-75-2 4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylic acid
Nama produk |
4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylic acid |
Nama bahasa Inggris |
4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylic acid;ethyl (2-chloro-6-ethoxy-4-formylphenoxy)acetate |
MF |
C13H15ClO5 |
Berat Molekul |
286.7082 |
InChI |
InChI=1/C13H15ClO5/c1-3-17-11-6-9(7-15)5-10(14)13(11)19-8-12(16)18-4-2/h5-7H,3-4,8H2,1-2H3 |
CAS NO |
6435-75-2 |
Struktur Molekul |
|
Kepadatan |
1.243g/cm3 |
Titik lebur |
198℃ |
Titik didih |
394.5°C at 760 mmHg |
Indeks bias |
1.533 |
Titik nyala |
155.5°C |
Tekanan uap |
1.97E-06mmHg at 25°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|