ChemNet > CAS > 652-32-4 2,3,5,6-Asam tetrafluoro-p-toluat
652-32-4 2,3,5,6-Asam tetrafluoro-p-toluat
| Nama produk |
2,3,5,6-Asam tetrafluoro-p-toluat |
| Sinonim |
; 2,3,5,6-Asam tetrafluoro-4-metilbenzoat; 2,3,5,6-tetrafluoro-4-metilbenzoat |
| Nama bahasa Inggris |
2,3,5,6-Tetrafluoro-p-toluic acid; 2,3,5,6-Tetrafluoro-4-methylbenzoic acid; 2,3,5,6-tetrafluoro-4-methylbenzoate |
| MF |
C8H3F4O2 |
| Berat Molekul |
207.1024 |
| InChI |
InChI=1/C8H4F4O2/c1-2-4(9)6(11)3(8(13)14)7(12)5(2)10/h1H3,(H,13,14)/p-1 |
| CAS NO |
652-32-4 |
| Struktur Molekul |
|
| Titik lebur |
168-175℃ |
| Titik didih |
255.8°C at 760 mmHg |
| Titik nyala |
108.5°C |
| Tekanan uap |
0.00822mmHg at 25°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
