ChemNet > CAS > 6575-09-3 2-Chloro-6-methylbenzonitrile
6575-09-3 2-Chloro-6-methylbenzonitrile
| Nama produk |
2-Chloro-6-methylbenzonitrile |
| Nama bahasa Inggris |
2-Chloro-6-methylbenzonitrile; 6-Chloro-o-tolunitrile; 3-chloro-2-toluonitrile |
| MF |
C8H6ClN |
| Berat Molekul |
151.5929 |
| InChI |
InChI=1/C8H6ClN/c1-6-3-2-4-8(9)7(6)5-10/h2-4H,1H3 |
| CAS NO |
6575-09-3 |
| EINECS |
229-499-5 |
| Struktur Molekul |
|
| Kepadatan |
1.19g/cm3 |
| Titik lebur |
78-83℃ |
| Titik didih |
241.1°C at 760 mmHg |
| Indeks bias |
1.553 |
| Titik nyala |
110.1°C |
| Tekanan uap |
0.0367mmHg at 25°C |
| Simbol bahaya |
 Xn:Harmful;
|
| Kode Risiko |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Keselamatan Deskripsi |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
