ChemNet > CAS > 65858-50-6 5-(bromomethyl)-2,1,3-benzothiadiazole
65858-50-6 5-(bromomethyl)-2,1,3-benzothiadiazole
| Nama produk |
5-(bromomethyl)-2,1,3-benzothiadiazole |
| Nama bahasa Inggris |
5-(bromomethyl)-2,1,3-benzothiadiazole; |
| MF |
C7H5BrN2S |
| Berat Molekul |
229.097 |
| InChI |
InChI=1/C7H5BrN2S/c8-4-5-1-2-6-7(3-5)10-11-9-6/h1-3H,4H2 |
| CAS NO |
65858-50-6 |
| Struktur Molekul |
|
| Kepadatan |
1.776g/cm3 |
| Titik lebur |
87℃ |
| Titik didih |
299.3°C at 760 mmHg |
| Indeks bias |
1.726 |
| Titik nyala |
134.8°C |
| Tekanan uap |
0.00214mmHg at 25°C |
| Simbol bahaya |
 C:Corrosive;
|
| Kode Risiko |
R34:Causes burns.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
