6587-24-2 methyl 2-cyanobenzoate
Nama produk |
methyl 2-cyanobenzoate |
Nama bahasa Inggris |
methyl 2-cyanobenzoate; |
MF |
C9H7NO2 |
Berat Molekul |
161.1574 |
InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-5-3-2-4-7(8)6-10/h2-5H,1H3 |
CAS NO |
6587-24-2 |
Struktur Molekul |
|
Kepadatan |
1.18g/cm3 |
Titik lebur |
47℃ |
Titik didih |
295.8°C at 760 mmHg |
Indeks bias |
1.535 |
Titik nyala |
136.2°C |
Tekanan uap |
0.00149mmHg at 25°C |
Simbol bahaya |
Xn:Harmful;
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|