ChemNet > CAS > 6639-79-8 2,3-Dihydroxy-6-chloroquinoxaline
6639-79-8 2,3-Dihydroxy-6-chloroquinoxaline
| Nama produk |
2,3-Dihydroxy-6-chloroquinoxaline |
| Nama bahasa Inggris |
2,3-Dihydroxy-6-chloroquinoxaline; |
| MF |
C8H5ClN2O2 |
| Berat Molekul |
196.59 |
| InChI |
InChI=1/C8H5ClN2O2/c9-4-1-2-5-6(3-4)11-8(13)7(12)10-5/h1-3H,(H,10,12)(H,11,13) |
| CAS NO |
6639-79-8 |
| EINECS |
229-647-9 |
| Struktur Molekul |
|
| Titik lebur |
250℃ |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
