ChemNet > CAS > 66424-91-7 5-Methyl-2-nitrobenzyl chloride
66424-91-7 5-Methyl-2-nitrobenzyl chloride
Nama produk |
5-Methyl-2-nitrobenzyl chloride |
Nama bahasa Inggris |
5-Methyl-2-nitrobenzyl chloride; alpha-chloro-5-methyl-2-nitrotoluene; 2-(chloromethyl)-4-methyl-1-nitrobenzene |
MF |
C8H8ClNO2 |
Berat Molekul |
185.6076 |
InChI |
InChI=1/C8H8ClNO2/c1-6-2-3-8(10(11)12)7(4-6)5-9/h2-4H,5H2,1H3 |
CAS NO |
66424-91-7 |
EINECS |
266-359-2 |
Struktur Molekul |
|
Kepadatan |
1.277g/cm3 |
Titik lebur |
41-43℃ |
Titik didih |
292.3°C at 760 mmHg |
Indeks bias |
1.566 |
Titik nyala |
130.6°C |
Tekanan uap |
0.00324mmHg at 25°C |
Simbol bahaya |
C:Corrosive;
|
Kode Risiko |
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|