ChemNet > CAS > 6670-13-9 4,5-Diphenyl-4-oxazoline-2-thione
6670-13-9 4,5-Diphenyl-4-oxazoline-2-thione
| Nama produk |
4,5-Diphenyl-4-oxazoline-2-thione |
| Nama bahasa Inggris |
4,5-Diphenyl-4-oxazoline-2-thione; 4,5-Diphenyl-2-oxazolethiol; 4,5-Diphenyl-2-mercaptooxazole; 4,5-diphenyl-1,3-oxazole-2(3H)-thione |
| MF |
C15H11NOS |
| Berat Molekul |
253.3189 |
| InChI |
InChI=1/C15H11NOS/c18-15-16-13(11-7-3-1-4-8-11)14(17-15)12-9-5-2-6-10-12/h1-10H,(H,16,18) |
| CAS NO |
6670-13-9 |
| EINECS |
229-707-4 |
| Struktur Molekul |
|
| Kepadatan |
1.31g/cm3 |
| Titik lebur |
256-260℃ |
| Titik didih |
390.6°C at 760 mmHg |
| Indeks bias |
1.708 |
| Titik nyala |
190.1°C |
| Tekanan uap |
2.61E-06mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|
